C23H30N2O3Si — CID 146169583
trimethyl-[2-[[4-(oxolan-3-yloxy)-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 146169583) has the molecular formula C23H30N2O3Si and a molecular weight of 410.59 g/mol. Its IUPAC name is trimethyl-[2-[[4-(oxolan-3-yloxy)-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-(oxolan-3-yloxy)-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 146169583 |
| Molecular Formula | C23H30N2O3Si |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | trimethyl-[2-[[4-(oxolan-3-yloxy)-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccccc2)c2c(OC3CCOC3)ccnc21 |
| InChI | InChI=1S/C23H30N2O3Si/c1-29(2,3)14-13-27-17-25-15-20(18-7-5-4-6-8-18)22-21(9-11-24-23(22)25)28-19-10-12-26-16-19/h4-9,11,15,19H,10,12-14,16-17H2,1-3H3 |
| InChIKey | YSGFKLBKBXTCQF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|