C23H27N3OSi — CID 146169697
trimethyl-[2-[(3-phenyl-4-pyrrol-1-ylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane (PubChem CID 146169697) has the molecular formula C23H27N3OSi and a molecular weight of 389.57 g/mol. Its IUPAC name is trimethyl-[2-[(3-phenyl-4-pyrrol-1-ylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(3-phenyl-4-pyrrol-1-ylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 146169697 |
| Molecular Formula | C23H27N3OSi |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | trimethyl-[2-[(3-phenyl-4-pyrrol-1-ylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccccc2)c2c(-n3cccc3)ccnc21 |
| InChI | InChI=1S/C23H27N3OSi/c1-28(2,3)16-15-27-18-26-17-20(19-9-5-4-6-10-19)22-21(11-12-24-23(22)26)25-13-7-8-14-25/h4-14,17H,15-16,18H2,1-3H3 |
| InChIKey | LNCDPGDKTOXEOT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|