C26H38N6OSi — CID 142530221
2-[[4-[(6S)-1,8-diazaspiro[5.5]undecan-8-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142530221) has the molecular formula C26H38N6OSi and a molecular weight of 478.72 g/mol. Its IUPAC name is 2-[[4-[(6S)-1,8-diazaspiro[5.5]undecan-8-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(6S)-1,8-diazaspiro[5.5]undecan-8-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142530221 |
| Molecular Formula | C26H38N6OSi |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 2-[[4-[(6S)-1,8-diazaspiro[5.5]undecan-8-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cncnc2)c2c(N3CCC[C@@]4(CCCCN4)C3)ccnc21 |
| InChI | InChI=1S/C26H38N6OSi/c1-34(2,3)14-13-33-20-32-17-22(21-15-27-19-28-16-21)24-23(7-11-29-25(24)32)31-12-6-9-26(18-31)8-4-5-10-30-26/h7,11,15-17,19,30H,4-6,8-10,12-14,18,20H2,1-3H3/t26-/m0/s1 |
| InChIKey | BWYFGMUWUMLWKX-SANMLTNESA-N |
| XLogP | 4.92 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|