C18H29N5OSi — CID 172817129
2-[[4-(1,7-diazaspiro[3.4]octan-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 172817129) has the molecular formula C18H29N5OSi and a molecular weight of 359.55 g/mol. Its IUPAC name is 2-[[4-(1,7-diazaspiro[3.4]octan-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(1,7-diazaspiro[3.4]octan-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 172817129 |
| Molecular Formula | C18H29N5OSi |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-[[4-(1,7-diazaspiro[3.4]octan-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(N3CCC4(CCN4)C3)ncnc21 |
| InChI | InChI=1S/C18H29N5OSi/c1-25(2,3)11-10-24-14-23-8-4-15-16(19-13-20-17(15)23)22-9-6-18(12-22)5-7-21-18/h4,8,13,21H,5-7,9-12,14H2,1-3H3 |
| InChIKey | SYNLFQVGCPOZFB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|