C27H39N5OSi — CID 153297382
2-[[4-[(3aR,7aS)-2-benzyl-3a-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153297382) has the molecular formula C27H39N5OSi and a molecular weight of 477.73 g/mol. Its IUPAC name is 2-[[4-[(3aR,7aS)-2-benzyl-3a-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(3aR,7aS)-2-benzyl-3a-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153297382 |
| Molecular Formula | C27H39N5OSi |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 2-[[4-[(3aR,7aS)-2-benzyl-3a-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[C@]12CN(Cc3ccccc3)C[C@H]1CCN(c1ncnc3c1ccn3COCC[Si](C)(C)C)C2 |
| InChI | InChI=1S/C27H39N5OSi/c1-27-18-30(16-22-8-6-5-7-9-22)17-23(27)10-12-31(19-27)25-24-11-13-32(26(24)29-20-28-25)21-33-14-15-34(2,3)4/h5-9,11,13,20,23H,10,12,14-19,21H2,1-4H3/t23-,27-/m1/s1 |
| InChIKey | GFCHRPLWTPEHET-YIXXDRMTSA-N |
| XLogP | 5.09 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|