C21H32N6OSi — CID 152620993
(3aS,7aS)-3a-methyl-5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonitrile (PubChem CID 152620993) has the molecular formula C21H32N6OSi and a molecular weight of 412.61 g/mol. Its IUPAC name is (3aS,7aS)-3a-methyl-5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonitrile.
| Compound Name | (3aS,7aS)-3a-methyl-5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 152620993 |
| Molecular Formula | C21H32N6OSi |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (3aS,7aS)-3a-methyl-5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonitrile |
| SMILES | C[C@]12CN(C#N)C[C@H]1CCN(c1ncnc3c1ccn3COCC[Si](C)(C)C)C2 |
| InChI | InChI=1S/C21H32N6OSi/c1-21-12-25(14-22)11-17(21)5-7-26(13-21)19-18-6-8-27(20(18)24-15-23-19)16-28-9-10-29(2,3)4/h6,8,15,17H,5,7,9-13,16H2,1-4H3/t17-,21-/m1/s1 |
| InChIKey | ZBNAYDCYVIKMPM-DYESRHJHSA-N |
| XLogP | 3.37 |
| TPSA | 70.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|