C17H29N5OSi — CID 66765875
(3R)-N-methyl-1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine (PubChem CID 66765875) has the molecular formula C17H29N5OSi and a molecular weight of 347.54 g/mol. Its IUPAC name is (3R)-N-methyl-1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine.
| Compound Name | (3R)-N-methyl-1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 66765875 |
| Molecular Formula | C17H29N5OSi |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (3R)-N-methyl-1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
| SMILES | CN[C@@H]1CCN(c2ncnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H29N5OSi/c1-18-14-5-7-21(11-14)16-15-6-8-22(17(15)20-12-19-16)13-23-9-10-24(2,3)4/h6,8,12,14,18H,5,7,9-11,13H2,1-4H3/t14-/m1/s1 |
| InChIKey | VDXHRMMXPCCFJQ-CQSZACIVSA-N |
| XLogP | 2.54 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|