C16H22N4OSi — CID 141424330
trimethyl-[2-[(4-pyrrol-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane (PubChem CID 141424330) has the molecular formula C16H22N4OSi and a molecular weight of 314.46 g/mol. Its IUPAC name is trimethyl-[2-[(4-pyrrol-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(4-pyrrol-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 141424330 |
| Molecular Formula | C16H22N4OSi |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | trimethyl-[2-[(4-pyrrol-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-n3cccc3)ncnc21 |
| InChI | InChI=1S/C16H22N4OSi/c1-22(2,3)11-10-21-13-20-9-6-14-15(17-12-18-16(14)20)19-7-4-5-8-19/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | ZLPMCNKAIHTNEY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|