C17H25N5OSi — CID 159253880
2-isocyano-N,N-dimethyl-2-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]ethenamine (PubChem CID 159253880) has the molecular formula C17H25N5OSi and a molecular weight of 343.51 g/mol. Its IUPAC name is 2-isocyano-N,N-dimethyl-2-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]ethenamine.
| Compound Name | 2-isocyano-N,N-dimethyl-2-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]ethenamine |
|---|---|
| PubChem CID | 159253880 |
| Molecular Formula | C17H25N5OSi |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-isocyano-N,N-dimethyl-2-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]ethenamine |
| SMILES | [C-]#[N+]C(=CN(C)C)c1ncnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C17H25N5OSi/c1-18-15(11-21(2)3)16-14-7-8-22(17(14)20-12-19-16)13-23-9-10-24(4,5)6/h7-8,11-12H,9-10,13H2,2-6H3 |
| InChIKey | KVQJPLBUKFUKSF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|