C16H22N6O2Si — CID 141450642
4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrazole-5-carboxamide (PubChem CID 141450642) has the molecular formula C16H22N6O2Si and a molecular weight of 358.48 g/mol. Its IUPAC name is 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141450642 |
| Molecular Formula | C16H22N6O2Si |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrazole-5-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cn[nH]c3C(N)=O)ncnc21 |
| InChI | InChI=1S/C16H22N6O2Si/c1-25(2,3)7-6-24-10-22-5-4-11-13(18-9-19-16(11)22)12-8-20-21-14(12)15(17)23/h4-5,8-9H,6-7,10H2,1-3H3,(H2,17,23)(H,20,21) |
| InChIKey | LALHMORMLSXKOE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|