C21H31N5O3Si — CID 58180959
ethyl 2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanoate (PubChem CID 58180959) has the molecular formula C21H31N5O3Si and a molecular weight of 429.60 g/mol. Its IUPAC name is ethyl 2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanoate.
| Compound Name | ethyl 2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanoate |
|---|---|
| PubChem CID | 58180959 |
| Molecular Formula | C21H31N5O3Si |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | ethyl 2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanoate |
| SMILES | CCOC(=O)C(CC)n1cc(-c2ncnc3c2ccn3COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C21H31N5O3Si/c1-6-18(21(27)29-7-2)26-13-16(12-24-26)19-17-8-9-25(20(17)23-14-22-19)15-28-10-11-30(3,4)5/h8-9,12-14,18H,6-7,10-11,15H2,1-5H3 |
| InChIKey | IRRVXDOZSMIDMC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|