C19H27ClN6OSi — CID 161133145
2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride (PubChem CID 161133145) has the molecular formula C19H27ClN6OSi and a molecular weight of 419.01 g/mol. Its IUPAC name is 2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride.
| Compound Name | 2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride |
|---|---|
| PubChem CID | 161133145 |
| Molecular Formula | C19H27ClN6OSi |
| Molecular Weight | 419.01 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride |
| SMILES | CCC(C#N)n1cc(-c2ncnc3c2ccn3COCC[Si](C)(C)C)cn1.Cl |
| InChI | InChI=1S/C19H26N6OSi.ClH/c1-5-16(10-20)25-12-15(11-23-25)18-17-6-7-24(19(17)22-13-21-18)14-26-8-9-27(2,3)4;/h6-7,11-13,16H,5,8-9,14H2,1-4H3;1H |
| InChIKey | UMLOFKKMZPJYKF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|