C21H30Cl2N6OSi — CID 67391357
2-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile;dihydrochloride (PubChem CID 67391357) has the molecular formula C21H30Cl2N6OSi and a molecular weight of 481.50 g/mol. Its IUPAC name is 2-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile;dihydrochloride.
| Compound Name | 2-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile;dihydrochloride |
|---|---|
| PubChem CID | 67391357 |
| Molecular Formula | C21H30Cl2N6OSi |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile;dihydrochloride |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3ccn(C4(CC#N)CNC4)c3)ncnc21.Cl.Cl |
| InChI | InChI=1S/C21H28N6OSi.2ClH/c1-29(2,3)11-10-28-16-26-8-5-18-19(24-15-25-20(18)26)17-4-9-27(12-17)21(6-7-22)13-23-14-21;;/h4-5,8-9,12,15,23H,6,10-11,13-14,16H2,1-3H3;2*1H |
| InChIKey | BVPZQQJOTXSJFB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|