C29H31N7O3Si — CID 174117854
2-[1-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile (PubChem CID 174117854) has the molecular formula C29H31N7O3Si and a molecular weight of 553.70 g/mol. Its IUPAC name is 2-[1-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile.
| Compound Name | 2-[1-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile |
|---|---|
| PubChem CID | 174117854 |
| Molecular Formula | C29H31N7O3Si |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 2-[1-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cn(C4(CC#N)CCC4)nc3N3C(=O)c4ccccc4C3=O)ncnc21 |
| InChI | InChI=1S/C29H31N7O3Si/c1-40(2,3)16-15-39-19-34-14-9-22-24(31-18-32-25(22)34)23-17-35(29(12-13-30)10-6-11-29)33-26(23)36-27(37)20-7-4-5-8-21(20)28(36)38/h4-5,7-9,14,17-18H,6,10-12,15-16,19H2,1-3H3 |
| InChIKey | SMMMCFVFZCDWSB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 118.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|