C27H33FN6O3SSi — CID 140752043
2-[1-ethylsulfonyl-3-[6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 140752043) has the molecular formula C27H33FN6O3SSi and a molecular weight of 568.75 g/mol. Its IUPAC name is 2-[1-ethylsulfonyl-3-[6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-ethylsulfonyl-3-[6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 140752043 |
| Molecular Formula | C27H33FN6O3SSi |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 2-[1-ethylsulfonyl-3-[6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CCS(=O)(=O)N1CC(CC#N)(n2cc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)c3ccc(F)cc32)C1 |
| InChI | InChI=1S/C27H33FN6O3SSi/c1-5-38(35,36)33-16-27(17-33,9-10-29)34-15-23(21-7-6-20(28)14-24(21)34)25-22-8-11-32(26(22)31-18-30-25)19-37-12-13-39(2,3)4/h6-8,11,14-15,18H,5,9,12-13,16-17,19H2,1-4H3 |
| InChIKey | PTFYICDVFOIXQW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|