C29H43FN4OSi2 — CID 140752047
[6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]-tri(propan-2-yl)silane (PubChem CID 140752047) has the molecular formula C29H43FN4OSi2 and a molecular weight of 538.86 g/mol. Its IUPAC name is [6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]-tri(propan-2-yl)silane.
| Compound Name | [6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 140752047 |
| Molecular Formula | C29H43FN4OSi2 |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | [6-fluoro-3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]indol-1-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(-c2ncnc3c2ccn3COCC[Si](C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C29H43FN4OSi2/c1-20(2)37(21(3)4,22(5)6)34-17-26(24-11-10-23(30)16-27(24)34)28-25-12-13-33(29(25)32-18-31-28)19-35-14-15-36(7,8)9/h10-13,16-18,20-22H,14-15,19H2,1-9H3 |
| InChIKey | QELRADPFJXXMRW-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|