C17H21N5OSi — CID 140923797
4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrole-3-carbonitrile (PubChem CID 140923797) has the molecular formula C17H21N5OSi and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrole-3-carbonitrile.
| Compound Name | 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 140923797 |
| Molecular Formula | C17H21N5OSi |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrole-3-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3c[nH]cc3C#N)ncnc21 |
| InChI | InChI=1S/C17H21N5OSi/c1-24(2,3)7-6-23-12-22-5-4-14-16(20-11-21-17(14)22)15-10-19-9-13(15)8-18/h4-5,9-11,19H,6-7,12H2,1-3H3 |
| InChIKey | XRZCYVGCYDSKSB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|