C12H20N4OSi — CID 70983690
7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 70983690) has the molecular formula C12H20N4OSi and a molecular weight of 264.40 g/mol. Its IUPAC name is 7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 70983690 |
| Molecular Formula | C12H20N4OSi |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C12H20N4OSi/c1-18(2,3)7-6-17-9-16-5-4-10-11(13)14-8-15-12(10)16/h4-5,8H,6-7,9H2,1-3H3,(H2,13,14,15) |
| InChIKey | UCWVXCSVPRLJEL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|