C14H20ClN3O2Si — CID 71258387
4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 71258387) has the molecular formula C14H20ClN3O2Si and a molecular weight of 325.87 g/mol. Its IUPAC name is 4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 71258387 |
| Molecular Formula | C14H20ClN3O2Si |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Cl)c(C(N)=O)cnc21 |
| InChI | InChI=1S/C14H20ClN3O2Si/c1-21(2,3)7-6-20-9-18-5-4-10-12(15)11(13(16)19)8-17-14(10)18/h4-5,8H,6-7,9H2,1-3H3,(H2,16,19) |
| InChIKey | PFUJUSBODRCXBD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|