C13H21N3OSi — CID 59420154
trimethyl-[2-[(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane (PubChem CID 59420154) has the molecular formula C13H21N3OSi and a molecular weight of 263.42 g/mol. Its IUPAC name is trimethyl-[2-[(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 59420154 |
| Molecular Formula | C13H21N3OSi |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | trimethyl-[2-[(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl]silane |
| SMILES | Cc1ncnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C13H21N3OSi/c1-11-12-5-6-16(13(12)15-9-14-11)10-17-7-8-18(2,3)4/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | AISKHOYWJYIWBA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|