C12H19N3OSi — CID 58172492
trimethyl-[2-(pyrrolo[2,3-d]pyrimidin-7-ylmethoxy)ethyl]silane (PubChem CID 58172492) has the molecular formula C12H19N3OSi and a molecular weight of 249.39 g/mol. Its IUPAC name is trimethyl-[2-(pyrrolo[2,3-d]pyrimidin-7-ylmethoxy)ethyl]silane.
| Compound Name | trimethyl-[2-(pyrrolo[2,3-d]pyrimidin-7-ylmethoxy)ethyl]silane |
|---|---|
| PubChem CID | 58172492 |
| Molecular Formula | C12H19N3OSi |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | trimethyl-[2-(pyrrolo[2,3-d]pyrimidin-7-ylmethoxy)ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc2cncnc21 |
| InChI | InChI=1S/C12H19N3OSi/c1-17(2,3)7-6-16-10-15-5-4-11-8-13-9-14-12(11)15/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | WUHSWAJJIXAIGL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|