C25H37N5O3Si2 — CID 67078620
3-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 67078620) has the molecular formula C25H37N5O3Si2 and a molecular weight of 511.78 g/mol. Its IUPAC name is 3-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 67078620 |
| Molecular Formula | C25H37N5O3Si2 |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 3-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc(-c3cnc4c(c3)[nH]c(=O)n4COCC[Si](C)(C)C)cnc21 |
| InChI | InChI=1S/C25H37N5O3Si2/c1-34(2,3)11-9-32-17-29-8-7-19-13-20(15-26-23(19)29)21-14-22-24(27-16-21)30(25(31)28-22)18-33-10-12-35(4,5)6/h7-8,13-16H,9-12,17-18H2,1-6H3,(H,28,31) |
| InChIKey | DQQSGBWCZRUFIY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|