C18H24N4O2Si — CID 141450408
3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyaniline (PubChem CID 141450408) has the molecular formula C18H24N4O2Si and a molecular weight of 356.50 g/mol. Its IUPAC name is 3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyaniline.
| Compound Name | 3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyaniline |
|---|---|
| PubChem CID | 141450408 |
| Molecular Formula | C18H24N4O2Si |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyaniline |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(Oc3cccc(N)c3)cnc21 |
| InChI | InChI=1S/C18H24N4O2Si/c1-25(2,3)10-9-23-13-22-8-7-16-18(22)20-12-17(21-16)24-15-6-4-5-14(19)11-15/h4-8,11-12H,9-10,13,19H2,1-3H3 |
| InChIKey | AKZSLJARYPCMIM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|