C18H30N6O2Si — CID 67431269
1-[(1R,3R)-3-aminocyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67431269) has the molecular formula C18H30N6O2Si and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-[(1R,3R)-3-aminocyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[(1R,3R)-3-aminocyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67431269 |
| Molecular Formula | C18H30N6O2Si |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[(1R,3R)-3-aminocyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)N[C@@H]3CC[C@@H](N)C3)cnc21 |
| InChI | InChI=1S/C18H30N6O2Si/c1-27(2,3)9-8-26-12-24-7-6-15-17(24)20-11-16(22-15)23-18(25)21-14-5-4-13(19)10-14/h6-7,11,13-14H,4-5,8-10,12,19H2,1-3H3,(H2,21,22,23,25)/t13-,14-/m1/s1 |
| InChIKey | HEMDNJXIEVZCBA-ZIAGYGMSSA-N |
| XLogP | 2.74 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|