C20H31F3N6O2Si — CID 67385703
1-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385703) has the molecular formula C20H31F3N6O2Si and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385703 |
| Molecular Formula | C20H31F3N6O2Si |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)NC3CCCN(CC(F)(F)F)C3)cnc21 |
| InChI | InChI=1S/C20H31F3N6O2Si/c1-32(2,3)10-9-31-14-29-8-6-16-18(29)24-11-17(26-16)27-19(30)25-15-5-4-7-28(12-15)13-20(21,22)23/h6,8,11,15H,4-5,7,9-10,12-14H2,1-3H3,(H2,25,26,27,30) |
| InChIKey | RONZRPZAAAEITG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|