C16H20FN5OSi — CID 58177356
2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58177356) has the molecular formula C16H20FN5OSi and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58177356 |
| Molecular Formula | C16H20FN5OSi |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(-c3nccnc3F)cnc21 |
| InChI | InChI=1S/C16H20FN5OSi/c1-24(2,3)9-8-23-11-22-7-4-12-16(22)20-10-13(21-12)14-15(17)19-6-5-18-14/h4-7,10H,8-9,11H2,1-3H3 |
| InChIKey | MFQSIPARFHQFGN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|