C17H20FIN4OSi — CID 58177445
2-[[2-(2-fluoro-3-pyridinyl)-7-iodopyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58177445) has the molecular formula C17H20FIN4OSi and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-[[2-(2-fluoro-3-pyridinyl)-7-iodopyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(2-fluoro-3-pyridinyl)-7-iodopyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58177445 |
| Molecular Formula | C17H20FIN4OSi |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 2-[[2-(2-fluoro-3-pyridinyl)-7-iodopyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(I)c2nc(-c3cccnc3F)cnc21 |
| InChI | InChI=1S/C17H20FIN4OSi/c1-25(2,3)8-7-24-11-23-10-13(19)15-17(23)21-9-14(22-15)12-5-4-6-20-16(12)18/h4-6,9-10H,7-8,11H2,1-3H3 |
| InChIKey | XXPOZGKRELPIDE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|