C21H31F3N6O3Si — CID 67385971
1-[1-(3,3,3-trifluoropropanoyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385971) has the molecular formula C21H31F3N6O3Si and a molecular weight of 500.60 g/mol. Its IUPAC name is 1-[1-(3,3,3-trifluoropropanoyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[1-(3,3,3-trifluoropropanoyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385971 |
| Molecular Formula | C21H31F3N6O3Si |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-[1-(3,3,3-trifluoropropanoyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)NC3CCCN(C(=O)CC(F)(F)F)C3)cnc21 |
| InChI | InChI=1S/C21H31F3N6O3Si/c1-34(2,3)10-9-33-14-30-8-6-16-19(30)25-12-17(27-16)28-20(32)26-15-5-4-7-29(13-15)18(31)11-21(22,23)24/h6,8,12,15H,4-5,7,9-11,13-14H2,1-3H3,(H2,26,27,28,32) |
| InChIKey | ISLWJVZJDADEBA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|