C18H27F3N6O4SSi — CID 67385725
1-[(3R)-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385725) has the molecular formula C18H27F3N6O4SSi and a molecular weight of 508.60 g/mol. Its IUPAC name is 1-[(3R)-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[(3R)-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385725 |
| Molecular Formula | C18H27F3N6O4SSi |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 1-[(3R)-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)N[C@@H]3CCN(S(=O)(=O)C(F)(F)F)C3)cnc21 |
| InChI | InChI=1S/C18H27F3N6O4SSi/c1-33(2,3)9-8-31-12-26-6-5-14-16(26)22-10-15(24-14)25-17(28)23-13-4-7-27(11-13)32(29,30)18(19,20)21/h5-6,10,13H,4,7-9,11-12H2,1-3H3,(H2,23,24,25,28)/t13-/m1/s1 |
| InChIKey | WVHZGWKHJIFNMQ-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|