C21H34N6O3Si — CID 67385825
1-[(1-acetylpiperidin-4-yl)methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385825) has the molecular formula C21H34N6O3Si and a molecular weight of 446.63 g/mol. Its IUPAC name is 1-[(1-acetylpiperidin-4-yl)methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[(1-acetylpiperidin-4-yl)methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385825 |
| Molecular Formula | C21H34N6O3Si |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-[(1-acetylpiperidin-4-yl)methyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | CC(=O)N1CCC(CNC(=O)Nc2cnc3c(ccn3COCC[Si](C)(C)C)n2)CC1 |
| InChI | InChI=1S/C21H34N6O3Si/c1-16(28)26-8-5-17(6-9-26)13-23-21(29)25-19-14-22-20-18(24-19)7-10-27(20)15-30-11-12-31(2,3)4/h7,10,14,17H,5-6,8-9,11-13,15H2,1-4H3,(H2,23,24,25,29) |
| InChIKey | HNVWYHXMOXPPMZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|