C19H34Cl2N6O2Si — CID 67385466
1-(piperidin-2-ylmethyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea;dihydrochloride (PubChem CID 67385466) has the molecular formula C19H34Cl2N6O2Si and a molecular weight of 477.51 g/mol. Its IUPAC name is 1-(piperidin-2-ylmethyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea;dihydrochloride.
| Compound Name | 1-(piperidin-2-ylmethyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea;dihydrochloride |
|---|---|
| PubChem CID | 67385466 |
| Molecular Formula | C19H34Cl2N6O2Si |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-(piperidin-2-ylmethyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea;dihydrochloride |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)NCC3CCCCN3)cnc21.Cl.Cl |
| InChI | InChI=1S/C19H32N6O2Si.2ClH/c1-28(2,3)11-10-27-14-25-9-7-16-18(25)21-13-17(23-16)24-19(26)22-12-15-6-4-5-8-20-15;;/h7,9,13,15,20H,4-6,8,10-12,14H2,1-3H3,(H2,22,23,24,26);2*1H |
| InChIKey | HWKYRXHJRJVIJH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|