C20H32N6O3Si — CID 67385980
1-(2-oxo-1-pyrrolidin-2-ylpropyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385980) has the molecular formula C20H32N6O3Si and a molecular weight of 432.60 g/mol. Its IUPAC name is 1-(2-oxo-1-pyrrolidin-2-ylpropyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-(2-oxo-1-pyrrolidin-2-ylpropyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385980 |
| Molecular Formula | C20H32N6O3Si |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-(2-oxo-1-pyrrolidin-2-ylpropyl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | CC(=O)C(NC(=O)Nc1cnc2c(ccn2COCC[Si](C)(C)C)n1)C1CCCN1 |
| InChI | InChI=1S/C20H32N6O3Si/c1-14(27)18(15-6-5-8-21-15)25-20(28)24-17-12-22-19-16(23-17)7-9-26(19)13-29-10-11-30(2,3)4/h7,9,12,15,18,21H,5-6,8,10-11,13H2,1-4H3,(H2,23,24,25,28) |
| InChIKey | PGMIGABKIFTJRB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|