C21H36N6O4SSi — CID 67385861
1-(1-propan-2-ylsulfonylpiperidin-3-yl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67385861) has the molecular formula C21H36N6O4SSi and a molecular weight of 496.71 g/mol. Its IUPAC name is 1-(1-propan-2-ylsulfonylpiperidin-3-yl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-(1-propan-2-ylsulfonylpiperidin-3-yl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67385861 |
| Molecular Formula | C21H36N6O4SSi |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 1-(1-propan-2-ylsulfonylpiperidin-3-yl)-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | CC(C)S(=O)(=O)N1CCCC(NC(=O)Nc2cnc3c(ccn3COCC[Si](C)(C)C)n2)C1 |
| InChI | InChI=1S/C21H36N6O4SSi/c1-16(2)32(29,30)27-9-6-7-17(14-27)23-21(28)25-19-13-22-20-18(24-19)8-10-26(20)15-31-11-12-33(3,4)5/h8,10,13,16-17H,6-7,9,11-12,14-15H2,1-5H3,(H2,23,24,25,28) |
| InChIKey | DJVRCIXNKDWGKW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|