C23H35F3N6O4SSi — CID 67386073
1-[1-(1-cyclopropyl-2,2,2-trifluoroethyl)sulfonylpiperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 67386073) has the molecular formula C23H35F3N6O4SSi and a molecular weight of 576.72 g/mol. Its IUPAC name is 1-[1-(1-cyclopropyl-2,2,2-trifluoroethyl)sulfonylpiperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[1-(1-cyclopropyl-2,2,2-trifluoroethyl)sulfonylpiperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 67386073 |
| Molecular Formula | C23H35F3N6O4SSi |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 1-[1-(1-cyclopropyl-2,2,2-trifluoroethyl)sulfonylpiperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)NC3CCCN(S(=O)(=O)C(C4CC4)C(F)(F)F)C3)cnc21 |
| InChI | InChI=1S/C23H35F3N6O4SSi/c1-38(2,3)12-11-36-15-31-10-8-18-21(31)27-13-19(29-18)30-22(33)28-17-5-4-9-32(14-17)37(34,35)20(16-6-7-16)23(24,25)26/h8,10,13,16-17,20H,4-7,9,11-12,14-15H2,1-3H3,(H2,28,29,30,33) |
| InChIKey | HDKGUMJVZFKPLH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|