C26H32N6O4Si — CID 86642313
1-[(1S,3S)-3-(1,3-dioxoisoindol-2-yl)cyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 86642313) has the molecular formula C26H32N6O4Si and a molecular weight of 520.67 g/mol. Its IUPAC name is 1-[(1S,3S)-3-(1,3-dioxoisoindol-2-yl)cyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-[(1S,3S)-3-(1,3-dioxoisoindol-2-yl)cyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 86642313 |
| Molecular Formula | C26H32N6O4Si |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 1-[(1S,3S)-3-(1,3-dioxoisoindol-2-yl)cyclopentyl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(NC(=O)N[C@H]3CC[C@H](N4C(=O)c5ccccc5C4=O)C3)cnc21 |
| InChI | InChI=1S/C26H32N6O4Si/c1-37(2,3)13-12-36-16-31-11-10-21-23(31)27-15-22(29-21)30-26(35)28-17-8-9-18(14-17)32-24(33)19-6-4-5-7-20(19)25(32)34/h4-7,10-11,15,17-18H,8-9,12-14,16H2,1-3H3,(H2,28,29,30,35)/t17-,18-/m0/s1 |
| InChIKey | LVKJDIKEJPVBNG-ROUUACIJSA-N |
| XLogP | 4.08 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|