C28H43N5O6Si — CID 175272598
1-cyclohexyl-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea (PubChem CID 175272598) has the molecular formula C28H43N5O6Si and a molecular weight of 573.77 g/mol. Its IUPAC name is 1-cyclohexyl-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-cyclohexyl-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 175272598 |
| Molecular Formula | C28H43N5O6Si |
| Molecular Weight | 573.77 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 1-cyclohexyl-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]urea |
| SMILES | CC1(C(=O)O)C=CCC(C(=O)O)(C2CCCCC2)C1.C[Si](C)(C)CCOCn1ccc2nc(NC(N)=O)cnc21 |
| InChI | InChI=1S/C15H22O4.C13H21N5O2Si/c1-14(12(16)17)8-5-9-15(10-14,13(18)19)11-6-3-2-4-7-11;1-21(2,3)7-6-20-9-18-5-4-10-12(18)15-8-11(16-10)17-13(14)19/h5,8,11H,2-4,6-7,9-10H2,1H3,(H,16,17)(H,18,19);4-5,8H,6-7,9H2,1-3H3,(H3,14,16,17,19) |
| InChIKey | ZFHGTBUJLVHCQL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.77 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|