C25H42N6O4Si — CID 67386251
tert-butyl 4-methyl-5-[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]azepane-1-carboxylate (PubChem CID 67386251) has the molecular formula C25H42N6O4Si and a molecular weight of 518.74 g/mol. Its IUPAC name is tert-butyl 4-methyl-5-[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-5-[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 67386251 |
| Molecular Formula | C25H42N6O4Si |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | tert-butyl 4-methyl-5-[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]azepane-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)CCC1NC(=O)Nc1cnc2c(ccn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C25H42N6O4Si/c1-18-8-11-30(24(33)35-25(2,3)4)12-9-19(18)28-23(32)29-21-16-26-22-20(27-21)10-13-31(22)17-34-14-15-36(5,6)7/h10,13,16,18-19H,8-9,11-12,14-15,17H2,1-7H3,(H2,27,28,29,32) |
| InChIKey | XFKOQJMUHVTWAT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|