C24H40N6O4Si — CID 67385024
tert-butyl 3-[[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]methyl]piperidine-1-carboxylate (PubChem CID 67385024) has the molecular formula C24H40N6O4Si and a molecular weight of 504.71 g/mol. Its IUPAC name is tert-butyl 3-[[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67385024 |
| Molecular Formula | C24H40N6O4Si |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | tert-butyl 3-[[[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamoylamino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNC(=O)Nc2cnc3c(ccn3COCC[Si](C)(C)C)n2)C1 |
| InChI | InChI=1S/C24H40N6O4Si/c1-24(2,3)34-23(32)29-10-7-8-18(16-29)14-26-22(31)28-20-15-25-21-19(27-20)9-11-30(21)17-33-12-13-35(4,5)6/h9,11,15,18H,7-8,10,12-14,16-17H2,1-6H3,(H2,26,27,28,31) |
| InChIKey | SHIUTWXJEKVGOF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|