C24H38N4O4Si — CID 58078671
tert-butyl 3-[[5-formyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 58078671) has the molecular formula C24H38N4O4Si and a molecular weight of 474.68 g/mol. Its IUPAC name is tert-butyl 3-[[5-formyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-formyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58078671 |
| Molecular Formula | C24H38N4O4Si |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | tert-butyl 3-[[5-formyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2c(C=O)cnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C24H38N4O4Si/c1-24(2,3)32-23(30)27-10-7-8-19(15-27)26-21-18(16-29)14-25-22-20(21)9-11-28(22)17-31-12-13-33(4,5)6/h9,11,14,16,19H,7-8,10,12-13,15,17H2,1-6H3,(H,25,26) |
| InChIKey | MZWWKFHMMDILKU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|