C20H37N3O3Si — CID 175182585
tert-butyl 3-[[1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]amino]piperidine-1-carboxylate (PubChem CID 175182585) has the molecular formula C20H37N3O3Si and a molecular weight of 395.62 g/mol. Its IUPAC name is tert-butyl 3-[[1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175182585 |
| Molecular Formula | C20H37N3O3Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | tert-butyl 3-[[1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2ccn(COCC[Si](C)(C)C)c2)C1 |
| InChI | InChI=1S/C20H37N3O3Si/c1-20(2,3)26-19(24)23-10-7-8-17(15-23)21-18-9-11-22(14-18)16-25-12-13-27(4,5)6/h9,11,14,17,21H,7-8,10,12-13,15-16H2,1-6H3 |
| InChIKey | MGUABFZXIILEGN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|