C26H43N5O3Si — CID 153450172
tert-butyl (3R)-3-[[5-(cyclopropylmethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 153450172) has the molecular formula C26H43N5O3Si and a molecular weight of 501.75 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-(cyclopropylmethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-(cyclopropylmethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 153450172 |
| Molecular Formula | C26H43N5O3Si |
| Molecular Weight | 501.75 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | tert-butyl (3R)-3-[[5-(cyclopropylmethyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2ncnc3c2c(CC2CC2)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C26H43N5O3Si/c1-26(2,3)34-25(32)30-11-7-8-21(16-30)29-23-22-20(14-19-9-10-19)15-31(24(22)28-17-27-23)18-33-12-13-35(4,5)6/h15,17,19,21H,7-14,16,18H2,1-6H3,(H,27,28,29)/t21-/m1/s1 |
| InChIKey | GEOBABOBPITSHA-OAQYLSRUSA-N |
| XLogP | 5.51 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.75 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|