C26H42N4O4Si — CID 177242977
tert-butyl 3-[5-(oxan-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-1-carboxylate (PubChem CID 177242977) has the molecular formula C26H42N4O4Si and a molecular weight of 502.73 g/mol. Its IUPAC name is tert-butyl 3-[5-(oxan-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-(oxan-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177242977 |
| Molecular Formula | C26H42N4O4Si |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | tert-butyl 3-[5-(oxan-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ncnc3c2c(C2CCOCC2)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C26H42N4O4Si/c1-26(2,3)34-25(31)29-10-7-20(15-29)23-22-21(19-8-11-32-12-9-19)16-30(24(22)28-17-27-23)18-33-13-14-35(4,5)6/h16-17,19-20H,7-15,18H2,1-6H3 |
| InChIKey | QAZVRUIEEGTBMW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|