C38H49N5O3Si — CID 170561376
4-tert-butyl-N-[[4-[5-(1-prop-2-enoylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide (PubChem CID 170561376) has the molecular formula C38H49N5O3Si and a molecular weight of 651.93 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-[5-(1-prop-2-enoylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[4-[5-(1-prop-2-enoylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 170561376 |
| Molecular Formula | C38H49N5O3Si |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | 4-tert-butyl-N-[[4-[5-(1-prop-2-enoylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide |
| SMILES | C=CC(=O)N1CCC(c2cn(COCC[Si](C)(C)C)c3ncnc(-c4ccc(CNC(=O)c5ccc(C(C)(C)C)cc5)cc4)c23)CC1 |
| InChI | InChI=1S/C38H49N5O3Si/c1-8-33(44)42-19-17-28(18-20-42)32-24-43(26-46-21-22-47(5,6)7)36-34(32)35(40-25-41-36)29-11-9-27(10-12-29)23-39-37(45)30-13-15-31(16-14-30)38(2,3)4/h8-16,24-25,28H,1,17-23,26H2,2-7H3,(H,39,45) |
| InChIKey | FLWBMEQNAUMJEL-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|