C40H53N5O2Si — CID 174147210
4-tert-butyl-N-[[4-[5-(1-but-2-ynylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]methyl]benzamide (PubChem CID 174147210) has the molecular formula C40H53N5O2Si and a molecular weight of 663.98 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-[5-(1-but-2-ynylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[4-[5-(1-but-2-ynylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]methyl]benzamide |
|---|---|
| PubChem CID | 174147210 |
| Molecular Formula | C40H53N5O2Si |
| Molecular Weight | 663.98 g/mol |
| Exact Mass | 663.40 |
| IUPAC Name | 4-tert-butyl-N-[[4-[5-(1-but-2-ynylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]methyl]benzamide |
| SMILES | CC#CCN1CCC(c2cn(COCC[Si](C)(C)C)c3ncnc(-c4ccc(CNC(=O)c5ccc(C(C)(C)C)cc5)c(C)c4)c23)CC1 |
| InChI | InChI=1S/C40H53N5O2Si/c1-9-10-19-44-20-17-30(18-21-44)35-26-45(28-47-22-23-48(6,7)8)38-36(35)37(42-27-43-38)32-11-12-33(29(2)24-32)25-41-39(46)31-13-15-34(16-14-31)40(3,4)5/h11-16,24,26-27,30H,17-23,25,28H2,1-8H3,(H,41,46) |
| InChIKey | FHKRJOUDEKMQJT-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.98 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|