C22H35ClN4O2Si — CID 177242980
trimethyl-[2-[[5-(oxan-4-yl)-4-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane;hydrochloride (PubChem CID 177242980) has the molecular formula C22H35ClN4O2Si and a molecular weight of 451.09 g/mol. Its IUPAC name is trimethyl-[2-[[5-(oxan-4-yl)-4-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane;hydrochloride.
| Compound Name | trimethyl-[2-[[5-(oxan-4-yl)-4-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane;hydrochloride |
|---|---|
| PubChem CID | 177242980 |
| Molecular Formula | C22H35ClN4O2Si |
| Molecular Weight | 451.09 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | trimethyl-[2-[[5-(oxan-4-yl)-4-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane;hydrochloride |
| SMILES | C[Si](C)(C)CCOCn1cc(C2CCOCC2)c2c(C3=CCNCC3)ncnc21.Cl |
| InChI | InChI=1S/C22H34N4O2Si.ClH/c1-29(2,3)13-12-28-16-26-14-19(17-6-10-27-11-7-17)20-21(24-15-25-22(20)26)18-4-8-23-9-5-18;/h4,14-15,17,23H,5-13,16H2,1-3H3;1H |
| InChIKey | NFRDZVRGFZZVPF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.09 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|