C38H51N5O2Si — CID 175963086
4-tert-butyl-N-[[4-[5-(1-prop-1-enylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide (PubChem CID 175963086) has the molecular formula C38H51N5O2Si and a molecular weight of 637.95 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-[5-(1-prop-1-enylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[4-[5-(1-prop-1-enylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 175963086 |
| Molecular Formula | C38H51N5O2Si |
| Molecular Weight | 637.95 g/mol |
| Exact Mass | 637.38 |
| IUPAC Name | 4-tert-butyl-N-[[4-[5-(1-prop-1-enylpiperidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide |
| SMILES | CC=CN1CCC(c2cn(COCC[Si](C)(C)C)c3ncnc(-c4ccc(CNC(=O)c5ccc(C(C)(C)C)cc5)cc4)c23)CC1 |
| InChI | InChI=1S/C38H51N5O2Si/c1-8-19-42-20-17-29(18-21-42)33-25-43(27-45-22-23-46(5,6)7)36-34(33)35(40-26-41-36)30-11-9-28(10-12-30)24-39-37(44)31-13-15-32(16-14-31)38(2,3)4/h8-16,19,25-26,29H,17-18,20-24,27H2,1-7H3,(H,39,44) |
| InChIKey | HTMHLQZABXSAFH-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.95 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|