C37H42FN5O3Si — CID 174147213
4-cyclopropyl-N-[[2-fluoro-4-[5-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide (PubChem CID 174147213) has the molecular formula C37H42FN5O3Si and a molecular weight of 651.86 g/mol. Its IUPAC name is 4-cyclopropyl-N-[[2-fluoro-4-[5-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide.
| Compound Name | 4-cyclopropyl-N-[[2-fluoro-4-[5-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 174147213 |
| Molecular Formula | C37H42FN5O3Si |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | 4-cyclopropyl-N-[[2-fluoro-4-[5-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]benzamide |
| SMILES | C=CC(=O)N1CC=C(c2cn(COCC[Si](C)(C)C)c3ncnc(-c4ccc(CNC(=O)c5ccc(C6CC6)cc5)c(F)c4)c23)CC1 |
| InChI | InChI=1S/C37H42FN5O3Si/c1-5-33(44)42-16-14-27(15-17-42)31-22-43(24-46-18-19-47(2,3)4)36-34(31)35(40-23-41-36)29-12-13-30(32(38)20-29)21-39-37(45)28-10-8-26(9-11-28)25-6-7-25/h5,8-14,20,22-23,25H,1,6-7,15-19,21,24H2,2-4H3,(H,39,45) |
| InChIKey | VMMLLJXZQVKJGO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|