C35H40FN5O2Si — CID 175963087
N-[[4-[5-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-fluorophenyl]methyl]benzamide (PubChem CID 175963087) has the molecular formula C35H40FN5O2Si and a molecular weight of 609.82 g/mol. Its IUPAC name is N-[[4-[5-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-fluorophenyl]methyl]benzamide.
| Compound Name | N-[[4-[5-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-fluorophenyl]methyl]benzamide |
|---|---|
| PubChem CID | 175963087 |
| Molecular Formula | C35H40FN5O2Si |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | N-[[4-[5-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2-fluorophenyl]methyl]benzamide |
| SMILES | CC#CCN1CC=C(c2cn(COCC[Si](C)(C)C)c3ncnc(-c4ccc(CNC(=O)c5ccccc5)c(F)c4)c23)CC1 |
| InChI | InChI=1S/C35H40FN5O2Si/c1-5-6-16-40-17-14-26(15-18-40)30-23-41(25-43-19-20-44(2,3)4)34-32(30)33(38-24-39-34)28-12-13-29(31(36)21-28)22-37-35(42)27-10-8-7-9-11-27/h7-14,21,23-24H,15-20,22,25H2,1-4H3,(H,37,42) |
| InChIKey | MMFZHYVLUSVXSW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|