C20H21N3O2 — CID 8758998
N'-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)acetyl]benzohydrazide (PubChem CID 8758998) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N'-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)acetyl]benzohydrazide.
| Compound Name | N'-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8758998 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N'-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)acetyl]benzohydrazide |
| SMILES | O=C(CN1CC=C(c2ccccc2)CC1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c24-19(21-22-20(25)18-9-5-2-6-10-18)15-23-13-11-17(12-14-23)16-7-3-1-4-8-16/h1-11H,12-15H2,(H,21,24)(H,22,25) |
| InChIKey | IDGOXBZZRXVYDC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|