C14H20N4O2 — CID 65449993
N'-[2-(3-methylpiperazin-1-yl)acetyl]benzohydrazide (PubChem CID 65449993) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N'-[2-(3-methylpiperazin-1-yl)acetyl]benzohydrazide.
| Compound Name | N'-[2-(3-methylpiperazin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 65449993 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N'-[2-(3-methylpiperazin-1-yl)acetyl]benzohydrazide |
| SMILES | CC1CN(CC(=O)NNC(=O)c2ccccc2)CCN1 |
| InChI | InChI=1S/C14H20N4O2/c1-11-9-18(8-7-15-11)10-13(19)16-17-14(20)12-5-3-2-4-6-12/h2-6,11,15H,7-10H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | JIKXUIDCEGJNIJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|